C44H72N4O5 — CID 153494203
3-[6-[4-[4-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxybutyl]-1,4-diazepan-1-yl]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 153494203) has the molecular formula C44H72N4O5 and a molecular weight of 737.08 g/mol. Its IUPAC name is 3-[6-[4-[4-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxybutyl]-1,4-diazepan-1-yl]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[4-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxybutyl]-1,4-diazepan-1-yl]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 153494203 |
| Molecular Formula | C44H72N4O5 |
| Molecular Weight | 737.08 g/mol |
| Exact Mass | 736.55 |
| IUPAC Name | 3-[6-[4-[4-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxybutyl]-1,4-diazepan-1-yl]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC/C(=C(\C1CCC(O)CC1)C1CCC(OCCCCN2CCCN(C3CCC4C(=O)N(C5CCC(=O)NC5=O)CC4C3)CC2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C44H72N4O5/c1-2-38(31-9-4-3-5-10-31)42(32-11-16-36(49)17-12-32)33-13-18-37(19-14-33)53-28-7-6-23-46-24-8-25-47(27-26-46)35-15-20-39-34(29-35)30-48(44(39)52)40-21-22-41(50)45-43(40)51/h31-37,39-40,49H,2-30H2,1H3,(H,45,50,51)/b42-38- |
| InChIKey | BQKJZXZXRXJUDE-CWAJCWQHSA-N |
| XLogP | 6.62 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.08 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|