C40H64N2O7 — CID 153494166
3-[6-[3-[2-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxyethoxy]propoxy]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 153494166) has the molecular formula C40H64N2O7 and a molecular weight of 684.96 g/mol. Its IUPAC name is 3-[6-[3-[2-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxyethoxy]propoxy]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[3-[2-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxyethoxy]propoxy]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 153494166 |
| Molecular Formula | C40H64N2O7 |
| Molecular Weight | 684.96 g/mol |
| Exact Mass | 684.47 |
| IUPAC Name | 3-[6-[3-[2-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxyethoxy]propoxy]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC/C(=C(\C1CCC(O)CC1)C1CCC(OCCOCCCOC2CCC3C(=O)N(C4CCC(=O)NC4=O)CC3C2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C40H64N2O7/c1-2-34(27-7-4-3-5-8-27)38(28-9-13-31(43)14-10-28)29-11-15-32(16-12-29)49-24-23-47-21-6-22-48-33-17-18-35-30(25-33)26-42(40(35)46)36-19-20-37(44)41-39(36)45/h27-33,35-36,43H,2-26H2,1H3,(H,41,44,45)/b38-34- |
| InChIKey | ZJBDMANPKTZWGG-RXJYLVDRSA-N |
| XLogP | 6.26 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.96 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|