C17H12F3N3 — CID 148829440
(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-10-yne (PubChem CID 148829440) has the molecular formula C17H12F3N3 and a molecular weight of 315.30 g/mol. Its IUPAC name is (9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-10-yne.
| Compound Name | (9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-10-yne |
|---|---|
| PubChem CID | 148829440 |
| Molecular Formula | C17H12F3N3 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-10-yne |
| SMILES | FC(F)(F)c1cccc(-c2ccc3c(n2)N[C@@H]2C#CN3CC2)c1 |
| InChI | InChI=1S/C17H12F3N3/c18-17(19,20)12-3-1-2-11(10-12)14-4-5-15-16(22-14)21-13-6-8-23(15)9-7-13/h1-5,10,13H,6,8H2,(H,21,22)/t13-/m0/s1 |
| InChIKey | OTJOGZUZARXHHQ-ZDUSSCGKSA-N |
| XLogP | 3.73 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|