C19H22N4O2S2 — CID 148868426
2-[[4-(2-ethylpiperidin-1-yl)quinazolin-7-yl]sulfonylmethyl]-1,3-thiazole (PubChem CID 148868426) has the molecular formula C19H22N4O2S2 and a molecular weight of 402.55 g/mol. Its IUPAC name is 2-[[4-(2-ethylpiperidin-1-yl)quinazolin-7-yl]sulfonylmethyl]-1,3-thiazole.
| Compound Name | 2-[[4-(2-ethylpiperidin-1-yl)quinazolin-7-yl]sulfonylmethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 148868426 |
| Molecular Formula | C19H22N4O2S2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-[[4-(2-ethylpiperidin-1-yl)quinazolin-7-yl]sulfonylmethyl]-1,3-thiazole |
| SMILES | CCC1CCCCN1c1ncnc2cc(S(=O)(=O)Cc3nccs3)ccc12 |
| InChI | InChI=1S/C19H22N4O2S2/c1-2-14-5-3-4-9-23(14)19-16-7-6-15(11-17(16)21-13-22-19)27(24,25)12-18-20-8-10-26-18/h6-8,10-11,13-14H,2-5,9,12H2,1H3 |
| InChIKey | PARIQVKTIREZDM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |