C8H17O6P — CID 14887752
(4S,5R)-5-dimethoxyphosphoryl-2-methoxyoxan-4-ol (PubChem CID 14887752) has the molecular formula C8H17O6P and a molecular weight of 240.19 g/mol. Its IUPAC name is (4S,5R)-5-dimethoxyphosphoryl-2-methoxyoxan-4-ol.
| Compound Name | (4S,5R)-5-dimethoxyphosphoryl-2-methoxyoxan-4-ol |
|---|---|
| PubChem CID | 14887752 |
| Molecular Formula | C8H17O6P |
| Molecular Weight | 240.19 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (4S,5R)-5-dimethoxyphosphoryl-2-methoxyoxan-4-ol |
| SMILES | COC1C[C@H](O)[C@H](P(=O)(OC)OC)CO1 |
| InChI | InChI=1S/C8H17O6P/c1-11-8-4-6(9)7(5-14-8)15(10,12-2)13-3/h6-9H,4-5H2,1-3H3/t6-,7+,8?/m0/s1 |
| InChIKey | JJNQDDFYTOIMLY-KJFJCRTCSA-N |
| XLogP | 0.59 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|