C14H20O4Si — CID 148878139
1-O-methyl 3-O-trimethylsilyl (2E)-2-(cyclohexa-1,3-dien-1-ylmethylidene)propanedioate (PubChem CID 148878139) has the molecular formula C14H20O4Si and a molecular weight of 280.40 g/mol. Its IUPAC name is 1-O-methyl 3-O-trimethylsilyl (2E)-2-(cyclohexa-1,3-dien-1-ylmethylidene)propanedioate.
| Compound Name | 1-O-methyl 3-O-trimethylsilyl (2E)-2-(cyclohexa-1,3-dien-1-ylmethylidene)propanedioate |
|---|---|
| PubChem CID | 148878139 |
| Molecular Formula | C14H20O4Si |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-O-methyl 3-O-trimethylsilyl (2E)-2-(cyclohexa-1,3-dien-1-ylmethylidene)propanedioate |
| SMILES | COC(=O)/C(=C\C1=CC=CCC1)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C14H20O4Si/c1-17-13(15)12(14(16)18-19(2,3)4)10-11-8-6-5-7-9-11/h5-6,8,10H,7,9H2,1-4H3/b12-10+ |
| InChIKey | PCNCOHVAOGBJGO-ZRDIBKRKSA-N |
| XLogP | 2.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|