C17H31N3O3 — CID 148903882
3-amino-5-hydroxy-4,4-dimethyl-N-[2-methyl-2-(2-methylpiperidin-1-yl)propanoyl]pent-2-enamide (PubChem CID 148903882) has the molecular formula C17H31N3O3 and a molecular weight of 325.45 g/mol. Its IUPAC name is 3-amino-5-hydroxy-4,4-dimethyl-N-[2-methyl-2-(2-methylpiperidin-1-yl)propanoyl]pent-2-enamide.
| Compound Name | 3-amino-5-hydroxy-4,4-dimethyl-N-[2-methyl-2-(2-methylpiperidin-1-yl)propanoyl]pent-2-enamide |
|---|---|
| PubChem CID | 148903882 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 3-amino-5-hydroxy-4,4-dimethyl-N-[2-methyl-2-(2-methylpiperidin-1-yl)propanoyl]pent-2-enamide |
| SMILES | CC1CCCCN1C(C)(C)C(=O)NC(=O)C=C(N)C(C)(C)CO |
| InChI | InChI=1S/C17H31N3O3/c1-12-8-6-7-9-20(12)17(4,5)15(23)19-14(22)10-13(18)16(2,3)11-21/h10,12,21H,6-9,11,18H2,1-5H3,(H,19,22,23) |
| InChIKey | MIRPXMZOCUVKQZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|