C17H31N3O2 — CID 173486390
N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]-2-methyl-2-(2-methylpiperidin-1-yl)propanamide (PubChem CID 173486390) has the molecular formula C17H31N3O2 and a molecular weight of 309.45 g/mol. Its IUPAC name is N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]-2-methyl-2-(2-methylpiperidin-1-yl)propanamide.
| Compound Name | N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]-2-methyl-2-(2-methylpiperidin-1-yl)propanamide |
|---|---|
| PubChem CID | 173486390 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]-2-methyl-2-(2-methylpiperidin-1-yl)propanamide |
| SMILES | [H]/N=C(\C=C(/O)C(C)(C)C)NC(=O)C(C)(C)N1CCCCC1C |
| InChI | InChI=1S/C17H31N3O2/c1-12-9-7-8-10-20(12)17(5,6)15(22)19-14(18)11-13(21)16(2,3)4/h11-12,21H,7-10H2,1-6H3,(H2,18,19,22)/b13-11- |
| InChIKey | CSKYLQLNHQHCNE-QBFSEMIESA-N |
| XLogP | 3.22 |
| TPSA | 76.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|