C18H24ClN3O2 — CID 173480363
(2S)-1-(4-chlorophenyl)-N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]pyrrolidine-2-carboxamide (PubChem CID 173480363) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is (2S)-1-(4-chlorophenyl)-N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(4-chlorophenyl)-N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 173480363 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (2S)-1-(4-chlorophenyl)-N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\C=C(/O)C(C)(C)C)NC(=O)[C@@H]1CCCN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClN3O2/c1-18(2,3)15(23)11-16(20)21-17(24)14-5-4-10-22(14)13-8-6-12(19)7-9-13/h6-9,11,14,23H,4-5,10H2,1-3H3,(H2,20,21,24)/b15-11-/t14-/m0/s1 |
| InChIKey | BRSBWXCYSMANOX-XFNCEPBJSA-N |
| XLogP | 3.89 |
| TPSA | 76.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|