C21H31ClN2O — CID 46844122
(2S)-N-(4-tert-butylcyclohexyl)-1-(4-chlorophenyl)pyrrolidine-2-carboxamide (PubChem CID 46844122) has the molecular formula C21H31ClN2O and a molecular weight of 362.95 g/mol. Its IUPAC name is (2S)-N-(4-tert-butylcyclohexyl)-1-(4-chlorophenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(4-tert-butylcyclohexyl)-1-(4-chlorophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 46844122 |
| Molecular Formula | C21H31ClN2O |
| Molecular Weight | 362.95 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (2S)-N-(4-tert-butylcyclohexyl)-1-(4-chlorophenyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C1CCC(NC(=O)[C@@H]2CCCN2c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H31ClN2O/c1-21(2,3)15-6-10-17(11-7-15)23-20(25)19-5-4-14-24(19)18-12-8-16(22)9-13-18/h8-9,12-13,15,17,19H,4-7,10-11,14H2,1-3H3,(H,23,25)/t15?,17?,19-/m0/s1 |
| InChIKey | XCYFMUKWDBQCFE-KVWWFHCMSA-N |
| XLogP | 5.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.95 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |