C20H17F3INO3 — CID 148911906
7-hydroxy-5-iodo-7-methyl-2-propyl-3-[4-(trifluoromethyl)phenyl]isoquinoline-6,8-dione (PubChem CID 148911906) has the molecular formula C20H17F3INO3 and a molecular weight of 503.26 g/mol. Its IUPAC name is 7-hydroxy-5-iodo-7-methyl-2-propyl-3-[4-(trifluoromethyl)phenyl]isoquinoline-6,8-dione.
| Compound Name | 7-hydroxy-5-iodo-7-methyl-2-propyl-3-[4-(trifluoromethyl)phenyl]isoquinoline-6,8-dione |
|---|---|
| PubChem CID | 148911906 |
| Molecular Formula | C20H17F3INO3 |
| Molecular Weight | 503.26 g/mol |
| Exact Mass | 503.02 |
| IUPAC Name | 7-hydroxy-5-iodo-7-methyl-2-propyl-3-[4-(trifluoromethyl)phenyl]isoquinoline-6,8-dione |
| SMILES | CCCN1C=C2C(=O)C(C)(O)C(=O)C(I)=C2C=C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17F3INO3/c1-3-8-25-10-14-13(16(24)18(27)19(2,28)17(14)26)9-15(25)11-4-6-12(7-5-11)20(21,22)23/h4-7,9-10,28H,3,8H2,1-2H3 |
| InChIKey | PIUKCTHRVPUAAZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.26 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|