C21H20F3NO3 — CID 152809621
7-hydroxy-7-methyl-2-(2-methylpropyl)-3-[4-(trifluoromethyl)phenyl]isoquinoline-6,8-dione (PubChem CID 152809621) has the molecular formula C21H20F3NO3 and a molecular weight of 391.39 g/mol. Its IUPAC name is 7-hydroxy-7-methyl-2-(2-methylpropyl)-3-[4-(trifluoromethyl)phenyl]isoquinoline-6,8-dione.
| Compound Name | 7-hydroxy-7-methyl-2-(2-methylpropyl)-3-[4-(trifluoromethyl)phenyl]isoquinoline-6,8-dione |
|---|---|
| PubChem CID | 152809621 |
| Molecular Formula | C21H20F3NO3 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 7-hydroxy-7-methyl-2-(2-methylpropyl)-3-[4-(trifluoromethyl)phenyl]isoquinoline-6,8-dione |
| SMILES | CC(C)CN1C=C2C(=O)C(C)(O)C(=O)C=C2C=C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20F3NO3/c1-12(2)10-25-11-16-14(9-18(26)20(3,28)19(16)27)8-17(25)13-4-6-15(7-5-13)21(22,23)24/h4-9,11-12,28H,10H2,1-3H3 |
| InChIKey | SQJKRUVDVYEUGK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|