C15H14N2O3 — CID 14893745
2-[5-(phenylmethoxymethyl)-1,3-dioxan-2-ylidene]propanedinitrile (PubChem CID 14893745) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-[5-(phenylmethoxymethyl)-1,3-dioxan-2-ylidene]propanedinitrile.
| Compound Name | 2-[5-(phenylmethoxymethyl)-1,3-dioxan-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 14893745 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-[5-(phenylmethoxymethyl)-1,3-dioxan-2-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1OCC(COCc2ccccc2)CO1 |
| InChI | InChI=1S/C15H14N2O3/c16-6-14(7-17)15-19-10-13(11-20-15)9-18-8-12-4-2-1-3-5-12/h1-5,13H,8-11H2 |
| InChIKey | SOSZUYYOLOYJJG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|