C34H28N8 — CID 14893833
3,7,20,24,35,38,39,42-octazaheptacyclo[24.8.4.49,18.029,37.032,36.012,41.015,40]dotetraconta-1(35),2,7,9(42),10,12(41),13,15(40),16,18(39),19,24,26(38),27,29(37),30,32(36),33-octadecaene (PubChem CID 14893833) has the molecular formula C34H28N8 and a molecular weight of 548.65 g/mol. Its IUPAC name is 3,7,20,24,35,38,39,42-octazaheptacyclo[24.8.4.49,18.029,37.032,36.012,41.015,40]dotetraconta-1(35),2,7,9(42),10,12(41),13,15(40),16,18(39),19,24,26(38),27,29(37),30,32(36),33-octadecaene.
| Compound Name | 3,7,20,24,35,38,39,42-octazaheptacyclo[24.8.4.49,18.029,37.032,36.012,41.015,40]dotetraconta-1(35),2,7,9(42),10,12(41),13,15(40),16,18(39),19,24,26(38),27,29(37),30,32(36),33-octadecaene |
|---|---|
| PubChem CID | 14893833 |
| Molecular Formula | C34H28N8 |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 3,7,20,24,35,38,39,42-octazaheptacyclo[24.8.4.49,18.029,37.032,36.012,41.015,40]dotetraconta-1(35),2,7,9(42),10,12(41),13,15(40),16,18(39),19,24,26(38),27,29(37),30,32(36),33-octadecaene |
| SMILES | C1=N/CCC/N=C/c2ccc3ccc4ccc(nc4c3n2)/C=N/CCC/N=C/c2ccc3ccc4ccc/1nc4c3n2 |
| InChI | InChI=1S/C34H28N8/c1-15-35-19-27-11-7-23-3-5-25-9-13-29(41-33(25)31(23)39-27)21-37-17-2-18-38-22-30-14-10-26-6-4-24-8-12-28(20-36-16-1)40-32(24)34(26)42-30/h3-14,19-22H,1-2,15-18H2/b35-19+,36-20+,37-21+,38-22+ |
| InChIKey | ANRYVKMMDDTBLL-NCEBZEIZSA-N |
| XLogP | 6.05 |
| TPSA | 101.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|