C20H20N2O3 — CID 149002729
3-[2-(2,3-dihydro-1H-indol-3-ylmethyl)-1H-indol-3-yl]-2-hydroxypropanoic acid (PubChem CID 149002729) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-[2-(2,3-dihydro-1H-indol-3-ylmethyl)-1H-indol-3-yl]-2-hydroxypropanoic acid.
| Compound Name | 3-[2-(2,3-dihydro-1H-indol-3-ylmethyl)-1H-indol-3-yl]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 149002729 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 3-[2-(2,3-dihydro-1H-indol-3-ylmethyl)-1H-indol-3-yl]-2-hydroxypropanoic acid |
| SMILES | O=C(O)C(O)Cc1c(CC2CNc3ccccc32)[nH]c2ccccc12 |
| InChI | InChI=1S/C20H20N2O3/c23-19(20(24)25)10-15-14-6-2-4-8-17(14)22-18(15)9-12-11-21-16-7-3-1-5-13(12)16/h1-8,12,19,21-23H,9-11H2,(H,24,25) |
| InChIKey | PZYYIBXSLNNDLU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|