C4F6IN3 — CID 149004629
1-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole (PubChem CID 149004629) has the molecular formula C4F6IN3 and a molecular weight of 330.96 g/mol. Its IUPAC name is 1-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole.
| Compound Name | 1-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 149004629 |
| Molecular Formula | C4F6IN3 |
| Molecular Weight | 330.96 g/mol |
| Exact Mass | 330.90 |
| IUPAC Name | 1-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole |
| SMILES | FC(F)(F)c1nc(C(F)(F)F)n(I)n1 |
| InChI | InChI=1S/C4F6IN3/c5-3(6,7)1-12-2(4(8,9)10)14(11)13-1 |
| InChIKey | QAIFTADLSZDKEI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.96 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|