C4F3N4- — CID 20746471
3-isocyano-5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene (PubChem CID 20746471) has the molecular formula C4F3N4- and a molecular weight of 161.07 g/mol. Its IUPAC name is 3-isocyano-5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene.
| Compound Name | 3-isocyano-5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene |
|---|---|
| PubChem CID | 20746471 |
| Molecular Formula | C4F3N4- |
| Molecular Weight | 161.07 g/mol |
| Exact Mass | 161.01 |
| IUPAC Name | 3-isocyano-5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene |
| SMILES | [C-]#[N+]c1nnc(C(F)(F)F)[n-]1 |
| InChI | InChI=1S/C4F3N4/c1-8-3-9-2(10-11-3)4(5,6)7/q-1 |
| InChIKey | GDMGMXYKAFKWCV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.07 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|