C4F3KN4 — CID 158223123
potassium 3-isocyano-5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene (PubChem CID 158223123) has the molecular formula C4F3KN4 and a molecular weight of 200.16 g/mol. Its IUPAC name is potassium 3-isocyano-5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene.
| Compound Name | potassium 3-isocyano-5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene |
|---|---|
| PubChem CID | 158223123 |
| Molecular Formula | C4F3KN4 |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 199.97 |
| IUPAC Name | potassium 3-isocyano-5-(trifluoromethyl)-1,2-diaza-4-azanidacyclopenta-2,5-diene |
| SMILES | [C-]#[N+]c1nnc(C(F)(F)F)[n-]1.[K+] |
| InChI | InChI=1S/C4F3N4.K/c1-8-3-9-2(10-11-3)4(5,6)7;/q-1;+1 |
| InChIKey | KLRCPLPRFBEXMM-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|