C15H20Cl2O4 — CID 149010266
2-[(2S,3R)-3-(3,4-dichlorophenyl)oxepan-2-yl]propane-1,2,3-triol (PubChem CID 149010266) has the molecular formula C15H20Cl2O4 and a molecular weight of 335.23 g/mol. Its IUPAC name is 2-[(2S,3R)-3-(3,4-dichlorophenyl)oxepan-2-yl]propane-1,2,3-triol.
| Compound Name | 2-[(2S,3R)-3-(3,4-dichlorophenyl)oxepan-2-yl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 149010266 |
| Molecular Formula | C15H20Cl2O4 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-[(2S,3R)-3-(3,4-dichlorophenyl)oxepan-2-yl]propane-1,2,3-triol |
| SMILES | OCC(O)(CO)[C@H]1OCCCC[C@@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2O4/c16-12-5-4-10(7-13(12)17)11-3-1-2-6-21-14(11)15(20,8-18)9-19/h4-5,7,11,14,18-20H,1-3,6,8-9H2/t11-,14+/m1/s1 |
| InChIKey | QBJUETZLOGSLOD-RISCZKNCSA-N |
| XLogP | 2.36 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |