C13H16Cl2O2 — CID 149258834
[(2S,3S)-3-(3,4-dichlorophenyl)oxepan-2-yl]methanol (PubChem CID 149258834) has the molecular formula C13H16Cl2O2 and a molecular weight of 275.17 g/mol. Its IUPAC name is [(2S,3S)-3-(3,4-dichlorophenyl)oxepan-2-yl]methanol.
| Compound Name | [(2S,3S)-3-(3,4-dichlorophenyl)oxepan-2-yl]methanol |
|---|---|
| PubChem CID | 149258834 |
| Molecular Formula | C13H16Cl2O2 |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | [(2S,3S)-3-(3,4-dichlorophenyl)oxepan-2-yl]methanol |
| SMILES | OC[C@H]1OCCCC[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2O2/c14-11-5-4-9(7-12(11)15)10-3-1-2-6-17-13(10)8-16/h4-5,7,10,13,16H,1-3,6,8H2/t10-,13+/m0/s1 |
| InChIKey | XOVRNRSZLNKTTQ-GXFFZTMASA-N |
| XLogP | 3.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |