C15H21Cl2NO3S — CID 158194929
N-[[(2S,3S)-3-(3,4-dichlorophenyl)oxepan-2-yl]methyl]ethanesulfonamide (PubChem CID 158194929) has the molecular formula C15H21Cl2NO3S and a molecular weight of 366.31 g/mol. Its IUPAC name is N-[[(2S,3S)-3-(3,4-dichlorophenyl)oxepan-2-yl]methyl]ethanesulfonamide.
| Compound Name | N-[[(2S,3S)-3-(3,4-dichlorophenyl)oxepan-2-yl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 158194929 |
| Molecular Formula | C15H21Cl2NO3S |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-[[(2S,3S)-3-(3,4-dichlorophenyl)oxepan-2-yl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC[C@H]1OCCCC[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H21Cl2NO3S/c1-2-22(19,20)18-10-15-12(5-3-4-8-21-15)11-6-7-13(16)14(17)9-11/h6-7,9,12,15,18H,2-5,8,10H2,1H3/t12-,15+/m0/s1 |
| InChIKey | GAFNFANOLNCNOB-SWLSCSKDSA-N |
| XLogP | 3.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |