C11H15Cl2N3O2S — CID 70837867
(2S,3S)-3-(3,4-dichlorophenyl)-2-[(sulfamoylamino)methyl]pyrrolidine (PubChem CID 70837867) has the molecular formula C11H15Cl2N3O2S and a molecular weight of 324.23 g/mol. Its IUPAC name is (2S,3S)-3-(3,4-dichlorophenyl)-2-[(sulfamoylamino)methyl]pyrrolidine.
| Compound Name | (2S,3S)-3-(3,4-dichlorophenyl)-2-[(sulfamoylamino)methyl]pyrrolidine |
|---|---|
| PubChem CID | 70837867 |
| Molecular Formula | C11H15Cl2N3O2S |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | (2S,3S)-3-(3,4-dichlorophenyl)-2-[(sulfamoylamino)methyl]pyrrolidine |
| SMILES | NS(=O)(=O)NC[C@H]1NCC[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H15Cl2N3O2S/c12-9-2-1-7(5-10(9)13)8-3-4-15-11(8)6-16-19(14,17)18/h1-2,5,8,11,15-16H,3-4,6H2,(H2,14,17,18)/t8-,11+/m0/s1 |
| InChIKey | QBYQPUUZBGOZIG-GZMMTYOYSA-N |
| XLogP | 1.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |