C18H19NO5S — CID 149019199
[1-(phenylmethoxycarbonylamino)cyclopropyl]methyl benzenesulfonate (PubChem CID 149019199) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is [1-(phenylmethoxycarbonylamino)cyclopropyl]methyl benzenesulfonate.
| Compound Name | [1-(phenylmethoxycarbonylamino)cyclopropyl]methyl benzenesulfonate |
|---|---|
| PubChem CID | 149019199 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [1-(phenylmethoxycarbonylamino)cyclopropyl]methyl benzenesulfonate |
| SMILES | O=C(NC1(COS(=O)(=O)c2ccccc2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO5S/c20-17(23-13-15-7-3-1-4-8-15)19-18(11-12-18)14-24-25(21,22)16-9-5-2-6-10-16/h1-10H,11-14H2,(H,19,20) |
| InChIKey | QDDDKIHGLIOXSY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|