C17H23F7O4 — CID 149025954
[(3R)-3,4,4,4-tetrafluoro-3-(2,2,2-trifluoroethoxycarbonyl)butan-2-yl] 1-(2,2-dimethylpropyl)-2-methylcyclopropane-1-carboxylate (PubChem CID 149025954) has the molecular formula C17H23F7O4 and a molecular weight of 424.35 g/mol. Its IUPAC name is [(3R)-3,4,4,4-tetrafluoro-3-(2,2,2-trifluoroethoxycarbonyl)butan-2-yl] 1-(2,2-dimethylpropyl)-2-methylcyclopropane-1-carboxylate.
| Compound Name | [(3R)-3,4,4,4-tetrafluoro-3-(2,2,2-trifluoroethoxycarbonyl)butan-2-yl] 1-(2,2-dimethylpropyl)-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 149025954 |
| Molecular Formula | C17H23F7O4 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | [(3R)-3,4,4,4-tetrafluoro-3-(2,2,2-trifluoroethoxycarbonyl)butan-2-yl] 1-(2,2-dimethylpropyl)-2-methylcyclopropane-1-carboxylate |
| SMILES | CC1CC1(CC(C)(C)C)C(=O)OC(C)[C@@](F)(C(=O)OCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H23F7O4/c1-9-6-14(9,7-13(3,4)5)11(25)28-10(2)16(21,17(22,23)24)12(26)27-8-15(18,19)20/h9-10H,6-8H2,1-5H3/t9?,10?,14?,16-/m1/s1 |
| InChIKey | QEKGJVMDVNODJE-HGDPKYQQSA-N |
| XLogP | 4.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |