C24H25ClFN3O3 — CID 149036461
1-[2-[[1-(4-chloro-2-fluorobenzoyl)azetidin-3-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one (PubChem CID 149036461) has the molecular formula C24H25ClFN3O3 and a molecular weight of 457.93 g/mol. Its IUPAC name is 1-[2-[[1-(4-chloro-2-fluorobenzoyl)azetidin-3-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one.
| Compound Name | 1-[2-[[1-(4-chloro-2-fluorobenzoyl)azetidin-3-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one |
|---|---|
| PubChem CID | 149036461 |
| Molecular Formula | C24H25ClFN3O3 |
| Molecular Weight | 457.93 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 1-[2-[[1-(4-chloro-2-fluorobenzoyl)azetidin-3-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one |
| SMILES | COCCCC(=O)c1ccc2nn(CC3CN(C(=O)c4ccc(Cl)cc4F)C3)cc2c1C |
| InChI | InChI=1S/C24H25ClFN3O3/c1-15-18(23(30)4-3-9-32-2)7-8-22-20(15)14-29(27-22)13-16-11-28(12-16)24(31)19-6-5-17(25)10-21(19)26/h5-8,10,14,16H,3-4,9,11-13H2,1-2H3 |
| InChIKey | QGSKRMDMVLHMHR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.93 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|