About CID 14905181
CID 14905181 (PubChem CID 14905181) has the molecular formula C8H16F3O3SSi
and a molecular weight of 277.36 g/mol.
Molecular Properties
| Compound Name | CID 14905181 |
| PubChem CID | 14905181 |
| Molecular Formula | C8H16F3O3SSi |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | — |
| SMILES | CC(C)[Si](OS(=O)(=O)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C8H16F3O3SSi/c1-6(2)16(7(3,4)5)14-15(12,13)8(9,10)11/h6H,1-5H3 |
| InChIKey | OHIHMBCMGATRNU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze CID 14905181 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 14905181?
The IUPAC name of CID 14905181 (CID 14905181) is not available.
What is the SMILES notation for CID 14905181?
The canonical SMILES for CID 14905181 is CC(C)[Si](OS(=O)(=O)C(F)(F)F)C(C)(C)C.
What is the InChIKey of CID 14905181?
The InChIKey is OHIHMBCMGATRNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3O3SSi/c1-6(2)16(7(3,4)5)14-15(12,13)8(9,10)11/h6H,1-5H3.
What are the key properties of CID 14905181?
CID 14905181 has a molecular weight of 277.36 g/mol, XLogP of 3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 14905181 is sourced from PubChem (CID 14905181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).