About iodozinc(1+);propylsulfinylbenzene
iodozinc(1+);propylsulfinylbenzene (PubChem CID 14906269) has the molecular formula C9H11IOSZn
and a molecular weight of 359.55 g/mol. Its IUPAC name is iodozinc(1+);propylsulfinylbenzene.
Molecular Properties
| Compound Name | iodozinc(1+);propylsulfinylbenzene |
| PubChem CID | 14906269 |
| Molecular Formula | C9H11IOSZn |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 357.89 |
| IUPAC Name | iodozinc(1+);propylsulfinylbenzene |
| SMILES | [CH2-]CCS(=O)c1ccccc1.[Zn+]I |
| InChI | InChI=1S/C9H11OS.HI.Zn/c1-2-8-11(10)9-6-4-3-5-7-9;;/h3-7H,1-2,8H2;1H;/q-1;;+2/p-1 |
| InChIKey | UEDGDFLOGZNUIE-UHFFFAOYSA-M |
| XLogP | 2.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodozinc(1+);propylsulfinylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodozinc(1+);propylsulfinylbenzene?
The IUPAC name of iodozinc(1+);propylsulfinylbenzene (CID 14906269) is iodozinc(1+);propylsulfinylbenzene.
What is the SMILES notation for iodozinc(1+);propylsulfinylbenzene?
The canonical SMILES for iodozinc(1+);propylsulfinylbenzene is [CH2-]CCS(=O)c1ccccc1.[Zn+]I.
What is the InChIKey of iodozinc(1+);propylsulfinylbenzene?
The InChIKey is UEDGDFLOGZNUIE-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H11OS.HI.Zn/c1-2-8-11(10)9-6-4-3-5-7-9;;/h3-7H,1-2,8H2;1H;/q-1;;+2/p-1.
What are the key properties of iodozinc(1+);propylsulfinylbenzene?
iodozinc(1+);propylsulfinylbenzene has a molecular weight of 359.55 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iodozinc(1+);propylsulfinylbenzene is sourced from PubChem (CID 14906269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).