C14H17NO4 — CID 149092417
tert-butyl 3,3-diethynyl-6-oxo-1,4-oxazepane-4-carboxylate (PubChem CID 149092417) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is tert-butyl 3,3-diethynyl-6-oxo-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl 3,3-diethynyl-6-oxo-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 149092417 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | tert-butyl 3,3-diethynyl-6-oxo-1,4-oxazepane-4-carboxylate |
| SMILES | C#CC1(C#C)COCC(=O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H17NO4/c1-6-14(7-2)10-18-9-11(16)8-15(14)12(17)19-13(3,4)5/h1-2H,8-10H2,3-5H3 |
| InChIKey | QSQPGTRVRAHAFC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|