C14H16N2O3 — CID 14909938
5-(1,3-dioxolan-2-yl)-1-(phenylmethoxymethyl)imidazole (PubChem CID 14909938) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 5-(1,3-dioxolan-2-yl)-1-(phenylmethoxymethyl)imidazole.
| Compound Name | 5-(1,3-dioxolan-2-yl)-1-(phenylmethoxymethyl)imidazole |
|---|---|
| PubChem CID | 14909938 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 5-(1,3-dioxolan-2-yl)-1-(phenylmethoxymethyl)imidazole |
| SMILES | c1ccc(COCn2cncc2C2OCCO2)cc1 |
| InChI | InChI=1S/C14H16N2O3/c1-2-4-12(5-3-1)9-17-11-16-10-15-8-13(16)14-18-6-7-19-14/h1-5,8,10,14H,6-7,9,11H2 |
| InChIKey | OVXUPKXHFGLOQU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |