C32H38F3N8O5+ — CID 149103832
[2-[1-[1-[(2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]ethoxycarbonyl-methylamino]phenyl]methyl (2S)-2,5-diaminopentanoate (PubChem CID 149103832) has the molecular formula C32H38F3N8O5+ and a molecular weight of 671.70 g/mol. Its IUPAC name is [2-[1-[1-[(2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]ethoxycarbonyl-methylamino]phenyl]methyl (2S)-2,5-diaminopentanoate.
| Compound Name | [2-[1-[1-[(2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]ethoxycarbonyl-methylamino]phenyl]methyl (2S)-2,5-diaminopentanoate |
|---|---|
| PubChem CID | 149103832 |
| Molecular Formula | C32H38F3N8O5+ |
| Molecular Weight | 671.70 g/mol |
| Exact Mass | 671.29 |
| IUPAC Name | [2-[1-[1-[(2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-2-hydroxybutyl]-1,2,4-triazol-4-ium-4-yl]ethoxycarbonyl-methylamino]phenyl]methyl (2S)-2,5-diaminopentanoate |
| SMILES | CC(OC(=O)N(C)c1ccccc1COC(=O)[C@@H](N)CCCN)[n+]1cnn(C[C@](O)(c2ccc(F)cc2F)[C@@H](C)c2ncncc2F)c1 |
| InChI | InChI=1S/C32H38F3N8O5/c1-20(29-26(35)14-38-17-39-29)32(46,24-11-10-23(33)13-25(24)34)16-43-19-42(18-40-43)21(2)48-31(45)41(3)28-9-5-4-7-22(28)15-47-30(44)27(37)8-6-12-36/h4-5,7,9-11,13-14,17-21,27,46H,6,8,12,15-16,36-37H2,1-3H3/q+1/t20-,21?,27-,32+/m0/s1 |
| InChIKey | QVGJODUSNRMZCT-GMBPIDKRSA-N |
| XLogP | 2.97 |
| TPSA | 175.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.70 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|