C17H17N5O2S3 — CID 149118688
4-[2-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine (PubChem CID 149118688) has the molecular formula C17H17N5O2S3 and a molecular weight of 419.56 g/mol. Its IUPAC name is 4-[2-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[2-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 149118688 |
| Molecular Formula | C17H17N5O2S3 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 4-[2-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
| SMILES | CS(=O)(=O)c1ccc(-c2nc(-c3csc(NC4=NCCCN4)n3)cs2)cc1 |
| InChI | InChI=1S/C17H17N5O2S3/c1-27(23,24)12-5-3-11(4-6-12)15-20-13(9-25-15)14-10-26-17(21-14)22-16-18-7-2-8-19-16/h3-6,9-10H,2,7-8H2,1H3,(H2,18,19,21,22) |
| InChIKey | QZBWKIQKDCYIQZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |