C20H21F3N2OS — CID 149142059
(5R)-6,6-difluoro-5-[2-fluoro-5-(pyridin-3-ylmethyl)phenyl]-5,7,7-trimethyl-1,4-oxazepane-3-thione (PubChem CID 149142059) has the molecular formula C20H21F3N2OS and a molecular weight of 394.46 g/mol. Its IUPAC name is (5R)-6,6-difluoro-5-[2-fluoro-5-(pyridin-3-ylmethyl)phenyl]-5,7,7-trimethyl-1,4-oxazepane-3-thione.
| Compound Name | (5R)-6,6-difluoro-5-[2-fluoro-5-(pyridin-3-ylmethyl)phenyl]-5,7,7-trimethyl-1,4-oxazepane-3-thione |
|---|---|
| PubChem CID | 149142059 |
| Molecular Formula | C20H21F3N2OS |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (5R)-6,6-difluoro-5-[2-fluoro-5-(pyridin-3-ylmethyl)phenyl]-5,7,7-trimethyl-1,4-oxazepane-3-thione |
| SMILES | CC1(C)OCC(=S)N[C@](C)(c2cc(Cc3cccnc3)ccc2F)C1(F)F |
| InChI | InChI=1S/C20H21F3N2OS/c1-18(2)20(22,23)19(3,25-17(27)12-26-18)15-10-13(6-7-16(15)21)9-14-5-4-8-24-11-14/h4-8,10-11H,9,12H2,1-3H3,(H,25,27)/t19-/m1/s1 |
| InChIKey | RIAWCFOWAWFNDD-LJQANCHMSA-N |
| XLogP | 4.39 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|