C13H11Cl2N3O — CID 149149167
N-(3-amino-5,6-dichloro-2-pyridinyl)-4-methylbenzamide (PubChem CID 149149167) has the molecular formula C13H11Cl2N3O and a molecular weight of 296.16 g/mol. Its IUPAC name is N-(3-amino-5,6-dichloro-2-pyridinyl)-4-methylbenzamide.
| Compound Name | N-(3-amino-5,6-dichloro-2-pyridinyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 149149167 |
| Molecular Formula | C13H11Cl2N3O |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | N-(3-amino-5,6-dichloro-2-pyridinyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc(Cl)c(Cl)cc2N)cc1 |
| InChI | InChI=1S/C13H11Cl2N3O/c1-7-2-4-8(5-3-7)13(19)18-12-10(16)6-9(14)11(15)17-12/h2-6H,16H2,1H3,(H,17,18,19) |
| InChIKey | UTSYZEDVDUERSJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|