C15H10Cl2F3N3O2 — CID 149149605
N-[5,6-dichloro-3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]-4-methylbenzamide (PubChem CID 149149605) has the molecular formula C15H10Cl2F3N3O2 and a molecular weight of 392.16 g/mol. Its IUPAC name is N-[5,6-dichloro-3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]-4-methylbenzamide.
| Compound Name | N-[5,6-dichloro-3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 149149605 |
| Molecular Formula | C15H10Cl2F3N3O2 |
| Molecular Weight | 392.16 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | N-[5,6-dichloro-3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc(Cl)c(Cl)cc2NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10Cl2F3N3O2/c1-7-2-4-8(5-3-7)13(24)23-12-10(6-9(16)11(17)22-12)21-14(25)15(18,19)20/h2-6H,1H3,(H,21,25)(H,22,23,24) |
| InChIKey | XTVVMRKQUWSHFE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.16 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|