C18H22OS — CID 14915891
3-(1,3-diphenylpropan-2-ylsulfanyl)propan-1-ol (PubChem CID 14915891) has the molecular formula C18H22OS and a molecular weight of 286.44 g/mol. Its IUPAC name is 3-(1,3-diphenylpropan-2-ylsulfanyl)propan-1-ol.
| Compound Name | 3-(1,3-diphenylpropan-2-ylsulfanyl)propan-1-ol |
|---|---|
| PubChem CID | 14915891 |
| Molecular Formula | C18H22OS |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3-(1,3-diphenylpropan-2-ylsulfanyl)propan-1-ol |
| SMILES | OCCCSC(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H22OS/c19-12-7-13-20-18(14-16-8-3-1-4-9-16)15-17-10-5-2-6-11-17/h1-6,8-11,18-19H,7,12-15H2 |
| InChIKey | SGQXYBVCMHBBON-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|