C19H23BrO2 — CID 149162662
(2E,5S,8aS)-2-[(3-bromophenyl)methylidene]-6-hydroxy-5,8a-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one (PubChem CID 149162662) has the molecular formula C19H23BrO2 and a molecular weight of 363.30 g/mol. Its IUPAC name is (2E,5S,8aS)-2-[(3-bromophenyl)methylidene]-6-hydroxy-5,8a-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one.
| Compound Name | (2E,5S,8aS)-2-[(3-bromophenyl)methylidene]-6-hydroxy-5,8a-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one |
|---|---|
| PubChem CID | 149162662 |
| Molecular Formula | C19H23BrO2 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (2E,5S,8aS)-2-[(3-bromophenyl)methylidene]-6-hydroxy-5,8a-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one |
| SMILES | C[C@@H]1C(O)CC[C@]2(C)C(=O)/C(=C/c3cccc(Br)c3)CCC12 |
| InChI | InChI=1S/C19H23BrO2/c1-12-16-7-6-14(10-13-4-3-5-15(20)11-13)18(22)19(16,2)9-8-17(12)21/h3-5,10-12,16-17,21H,6-9H2,1-2H3/b14-10+/t12-,16?,17?,19-/m0/s1 |
| InChIKey | UNMNCWPFIDZMOO-MVDANUPASA-N |
| XLogP | 4.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|