C21H25FO2 — CID 153485565
(2E,4aR,5R,8aR)-2-[(2-fluorophenyl)methylidene]-6-hydroxy-8a-methyl-5-prop-2-enyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one (PubChem CID 153485565) has the molecular formula C21H25FO2 and a molecular weight of 328.43 g/mol. Its IUPAC name is (2E,4aR,5R,8aR)-2-[(2-fluorophenyl)methylidene]-6-hydroxy-8a-methyl-5-prop-2-enyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one.
| Compound Name | (2E,4aR,5R,8aR)-2-[(2-fluorophenyl)methylidene]-6-hydroxy-8a-methyl-5-prop-2-enyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one |
|---|---|
| PubChem CID | 153485565 |
| Molecular Formula | C21H25FO2 |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (2E,4aR,5R,8aR)-2-[(2-fluorophenyl)methylidene]-6-hydroxy-8a-methyl-5-prop-2-enyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one |
| SMILES | C=CC[C@H]1C(O)CC[C@@]2(C)C(=O)/C(=C/c3ccccc3F)CC[C@H]12 |
| InChI | InChI=1S/C21H25FO2/c1-3-6-16-17-10-9-15(13-14-7-4-5-8-18(14)22)20(24)21(17,2)12-11-19(16)23/h3-5,7-8,13,16-17,19,23H,1,6,9-12H2,2H3/b15-13+/t16-,17-,19?,21-/m1/s1 |
| InChIKey | IKEQVHUGSRHECV-DRCGKLTKSA-N |
| XLogP | 4.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|