C14H17N3O3 — CID 149163527
ethyl 3-[4-(N'-hydroxycarbamimidoyl)-1H-indol-7-yl]propanoate (PubChem CID 149163527) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is ethyl 3-[4-(N'-hydroxycarbamimidoyl)-1H-indol-7-yl]propanoate.
| Compound Name | ethyl 3-[4-(N'-hydroxycarbamimidoyl)-1H-indol-7-yl]propanoate |
|---|---|
| PubChem CID | 149163527 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | ethyl 3-[4-(N'-hydroxycarbamimidoyl)-1H-indol-7-yl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(C(N)=NO)c2cc[nH]c12 |
| InChI | InChI=1S/C14H17N3O3/c1-2-20-12(18)6-4-9-3-5-11(14(15)17-19)10-7-8-16-13(9)10/h3,5,7-8,16,19H,2,4,6H2,1H3,(H2,15,17) |
| InChIKey | KTKJOBSZBZGOME-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|