C14H16FN3O3 — CID 72528333
ethyl 3-[5-fluoro-7-(N'-hydroxycarbamimidoyl)-1H-indol-3-yl]propanoate (PubChem CID 72528333) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is ethyl 3-[5-fluoro-7-(N'-hydroxycarbamimidoyl)-1H-indol-3-yl]propanoate.
| Compound Name | ethyl 3-[5-fluoro-7-(N'-hydroxycarbamimidoyl)-1H-indol-3-yl]propanoate |
|---|---|
| PubChem CID | 72528333 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | ethyl 3-[5-fluoro-7-(N'-hydroxycarbamimidoyl)-1H-indol-3-yl]propanoate |
| SMILES | CCOC(=O)CCc1c[nH]c2c(C(N)=NO)cc(F)cc12 |
| InChI | InChI=1S/C14H16FN3O3/c1-2-21-12(19)4-3-8-7-17-13-10(8)5-9(15)6-11(13)14(16)18-20/h5-7,17,20H,2-4H2,1H3,(H2,16,18) |
| InChIKey | RKDITUNMOALEDB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|