C16H21N3O3 — CID 173040182
2-ethyl-5-[7-(N'-hydroxycarbamimidoyl)-1H-indol-3-yl]pentanoic acid (PubChem CID 173040182) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-ethyl-5-[7-(N'-hydroxycarbamimidoyl)-1H-indol-3-yl]pentanoic acid.
| Compound Name | 2-ethyl-5-[7-(N'-hydroxycarbamimidoyl)-1H-indol-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 173040182 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-ethyl-5-[7-(N'-hydroxycarbamimidoyl)-1H-indol-3-yl]pentanoic acid |
| SMILES | CCC(CCCc1c[nH]c2c(C(N)=NO)cccc12)C(=O)O |
| InChI | InChI=1S/C16H21N3O3/c1-2-10(16(20)21)5-3-6-11-9-18-14-12(11)7-4-8-13(14)15(17)19-22/h4,7-10,18,22H,2-3,5-6H2,1H3,(H2,17,19)(H,20,21) |
| InChIKey | JMOYTSVPPZLZOD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 111.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|