C12H15FN4O3 — CID 149173311
N-[[(5S)-3-(6-fluoro-1-methanimidoyl-2H-pyridin-4-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 149173311) has the molecular formula C12H15FN4O3 and a molecular weight of 282.27 g/mol. Its IUPAC name is N-[[(5S)-3-(6-fluoro-1-methanimidoyl-2H-pyridin-4-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-(6-fluoro-1-methanimidoyl-2H-pyridin-4-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 149173311 |
| Molecular Formula | C12H15FN4O3 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-[[(5S)-3-(6-fluoro-1-methanimidoyl-2H-pyridin-4-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | [H]/N=C/N1CC=C(N2C[C@H](CNC(C)=O)OC2=O)C=C1F |
| InChI | InChI=1S/C12H15FN4O3/c1-8(18)15-5-10-6-17(12(19)20-10)9-2-3-16(7-14)11(13)4-9/h2,4,7,10,14H,3,5-6H2,1H3,(H,15,18)/b14-7+/t10-/m0/s1 |
| InChIKey | WZMHJXOGJIRJJN-UQDQQJHMSA-N |
| XLogP | 0.56 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|