C10H17N — CID 149175379
5-butan-2-yl-1-azatricyclo[4.1.0.02,4]heptane (PubChem CID 149175379) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 5-butan-2-yl-1-azatricyclo[4.1.0.02,4]heptane.
| Compound Name | 5-butan-2-yl-1-azatricyclo[4.1.0.02,4]heptane |
|---|---|
| PubChem CID | 149175379 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 5-butan-2-yl-1-azatricyclo[4.1.0.02,4]heptane |
| SMILES | CCC(C)C1C2CC2N2CC12 |
| InChI | InChI=1S/C10H17N/c1-3-6(2)10-7-4-8(7)11-5-9(10)11/h6-10H,3-5H2,1-2H3 |
| InChIKey | WZWOASXPBVUUFL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|