C13H16O2 — CID 14920001
3,3-dimethyl-1-(2-methylphenyl)butane-1,2-dione (PubChem CID 14920001) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-methylphenyl)butane-1,2-dione.
| Compound Name | 3,3-dimethyl-1-(2-methylphenyl)butane-1,2-dione |
|---|---|
| PubChem CID | 14920001 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 3,3-dimethyl-1-(2-methylphenyl)butane-1,2-dione |
| SMILES | Cc1ccccc1C(=O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C13H16O2/c1-9-7-5-6-8-10(9)11(14)12(15)13(2,3)4/h5-8H,1-4H3 |
| InChIKey | YFFKSROTMPMAET-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|