C14H18O2 — CID 149200276
(2S)-2-[(1-methyl-1,7,8,8a-tetrahydronaphthalen-2-yl)oxymethyl]oxirane (PubChem CID 149200276) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (2S)-2-[(1-methyl-1,7,8,8a-tetrahydronaphthalen-2-yl)oxymethyl]oxirane.
| Compound Name | (2S)-2-[(1-methyl-1,7,8,8a-tetrahydronaphthalen-2-yl)oxymethyl]oxirane |
|---|---|
| PubChem CID | 149200276 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (2S)-2-[(1-methyl-1,7,8,8a-tetrahydronaphthalen-2-yl)oxymethyl]oxirane |
| SMILES | CC1C(OC[C@@H]2CO2)=CC=C2C=CCCC21 |
| InChI | InChI=1S/C14H18O2/c1-10-13-5-3-2-4-11(13)6-7-14(10)16-9-12-8-15-12/h2,4,6-7,10,12-13H,3,5,8-9H2,1H3/t10?,12-,13?/m0/s1 |
| InChIKey | XEODBBUMUOZRKY-YDGIUTOCSA-N |
| XLogP | 2.83 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|