C32H64N2O2S4 — CID 149217383
4-[2-[[3-(3,3-dimethylbutyl)-3,10,10-trimethyl-5-(2-morpholin-4-ylethyldisulfanyl)undecyl]disulfanyl]ethyl]morpholine (PubChem CID 149217383) has the molecular formula C32H64N2O2S4 and a molecular weight of 637.14 g/mol. Its IUPAC name is 4-[2-[[3-(3,3-dimethylbutyl)-3,10,10-trimethyl-5-(2-morpholin-4-ylethyldisulfanyl)undecyl]disulfanyl]ethyl]morpholine.
| Compound Name | 4-[2-[[3-(3,3-dimethylbutyl)-3,10,10-trimethyl-5-(2-morpholin-4-ylethyldisulfanyl)undecyl]disulfanyl]ethyl]morpholine |
|---|---|
| PubChem CID | 149217383 |
| Molecular Formula | C32H64N2O2S4 |
| Molecular Weight | 637.14 g/mol |
| Exact Mass | 636.39 |
| IUPAC Name | 4-[2-[[3-(3,3-dimethylbutyl)-3,10,10-trimethyl-5-(2-morpholin-4-ylethyldisulfanyl)undecyl]disulfanyl]ethyl]morpholine |
| SMILES | CC(C)(C)CCCCC(CC(C)(CCSSCCN1CCOCC1)CCC(C)(C)C)SSCCN1CCOCC1 |
| InChI | InChI=1S/C32H64N2O2S4/c1-30(2,3)11-9-8-10-29(40-39-27-20-34-17-23-36-24-18-34)28-32(7,13-12-31(4,5)6)14-25-37-38-26-19-33-15-21-35-22-16-33/h29H,8-28H2,1-7H3 |
| InChIKey | XHTQADYXHLNHDK-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.14 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|