C16H33NOS2 — CID 126560737
4-[2-(3,3,6-trimethylheptyldisulfanyl)ethyl]morpholine (PubChem CID 126560737) has the molecular formula C16H33NOS2 and a molecular weight of 319.58 g/mol. Its IUPAC name is 4-[2-(3,3,6-trimethylheptyldisulfanyl)ethyl]morpholine.
| Compound Name | 4-[2-(3,3,6-trimethylheptyldisulfanyl)ethyl]morpholine |
|---|---|
| PubChem CID | 126560737 |
| Molecular Formula | C16H33NOS2 |
| Molecular Weight | 319.58 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 4-[2-(3,3,6-trimethylheptyldisulfanyl)ethyl]morpholine |
| SMILES | CC(C)CCC(C)(C)CCSSCCN1CCOCC1 |
| InChI | InChI=1S/C16H33NOS2/c1-15(2)5-6-16(3,4)7-13-19-20-14-10-17-8-11-18-12-9-17/h15H,5-14H2,1-4H3 |
| InChIKey | IRAMOAWEMQCCFB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|