C8H14NO3Y- — CID 149241062
(1-methoxy-1,5-dioxohexan-2-yl)-methylazanide;yttrium (PubChem CID 149241062) has the molecular formula C8H14NO3Y- and a molecular weight of 261.11 g/mol. Its IUPAC name is (1-methoxy-1,5-dioxohexan-2-yl)-methylazanide;yttrium.
| Compound Name | (1-methoxy-1,5-dioxohexan-2-yl)-methylazanide;yttrium |
|---|---|
| PubChem CID | 149241062 |
| Molecular Formula | C8H14NO3Y- |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | (1-methoxy-1,5-dioxohexan-2-yl)-methylazanide;yttrium |
| SMILES | C[N-]C(CCC(C)=O)C(=O)OC.[Y] |
| InChI | InChI=1S/C8H14NO3.Y/c1-6(10)4-5-7(9-2)8(11)12-3;/h7H,4-5H2,1-3H3;/q-1; |
| InChIKey | VRNLIJMYLLLYRA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 57.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |