About 5-hydrazinylhexan-2-one
5-hydrazinylhexan-2-one (PubChem CID 90310478) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is 5-hydrazinylhexan-2-one.
Molecular Properties
| Compound Name | 5-hydrazinylhexan-2-one |
| PubChem CID | 90310478 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | 5-hydrazinylhexan-2-one |
| SMILES | CC(=O)CCC(C)NN |
| InChI | InChI=1S/C6H14N2O/c1-5(8-7)3-4-6(2)9/h5,8H,3-4,7H2,1-2H3 |
| InChIKey | SOUQEGNRFOEXLE-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-hydrazinylhexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydrazinylhexan-2-one?
The IUPAC name of 5-hydrazinylhexan-2-one (CID 90310478) is 5-hydrazinylhexan-2-one.
What is the SMILES notation for 5-hydrazinylhexan-2-one?
The canonical SMILES for 5-hydrazinylhexan-2-one is CC(=O)CCC(C)NN.
What is the InChIKey of 5-hydrazinylhexan-2-one?
The InChIKey is SOUQEGNRFOEXLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O/c1-5(8-7)3-4-6(2)9/h5,8H,3-4,7H2,1-2H3.
What are the key properties of 5-hydrazinylhexan-2-one?
5-hydrazinylhexan-2-one has a molecular weight of 130.19 g/mol, XLogP of 0.21, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydrazinylhexan-2-one is sourced from PubChem (CID 90310478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).