C13H19N — CID 149280961
(2R)-6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine (PubChem CID 149280961) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (2R)-6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine.
| Compound Name | (2R)-6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 149280961 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (2R)-6-(3,3-dimethylbut-1-ynyl)-2-ethyl-2,3-dihydropyridine |
| SMILES | CC[C@@H]1CC=CC(C#CC(C)(C)C)=N1 |
| InChI | InChI=1S/C13H19N/c1-5-11-7-6-8-12(14-11)9-10-13(2,3)4/h6,8,11H,5,7H2,1-4H3/t11-/m1/s1 |
| InChIKey | XSYDZMIFSWMFRY-LLVKDONJSA-N |
| XLogP | 3.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|