C45H34IrN2O2-2 — CID 149296201
4-hydroxypent-3-en-2-one;iridium;2-phenyl-4-[2-[3-[3-(6-phenyl-3-pyridinyl)phenyl]phenyl]phenyl]pyridine (PubChem CID 149296201) has the molecular formula C45H34IrN2O2-2 and a molecular weight of 827.00 g/mol. Its IUPAC name is 4-hydroxypent-3-en-2-one;iridium;2-phenyl-4-[2-[3-[3-(6-phenyl-3-pyridinyl)phenyl]phenyl]phenyl]pyridine.
| Compound Name | 4-hydroxypent-3-en-2-one;iridium;2-phenyl-4-[2-[3-[3-(6-phenyl-3-pyridinyl)phenyl]phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 149296201 |
| Molecular Formula | C45H34IrN2O2-2 |
| Molecular Weight | 827.00 g/mol |
| Exact Mass | 827.23 |
| IUPAC Name | 4-hydroxypent-3-en-2-one;iridium;2-phenyl-4-[2-[3-[3-(6-phenyl-3-pyridinyl)phenyl]phenyl]phenyl]pyridine |
| SMILES | CC(=O)C=C(C)O.[Ir].[c-]1ccccc1-c1ccc(-c2cccc(-c3cccc(-c4ccccc4-c4ccnc(-c5[c-]cccc5)c4)c3)c2)cn1 |
| InChI | InChI=1S/C40H26N2.C5H8O2.Ir/c1-3-11-29(12-4-1)39-22-21-36(28-42-39)33-17-9-15-31(25-33)32-16-10-18-34(26-32)37-19-7-8-20-38(37)35-23-24-41-40(27-35)30-13-5-2-6-14-30;1-4(6)3-5(2)7;/h1-11,13,15-28H;3,6H,1-2H3;/q-2;; |
| InChIKey | SRVFQWKTLQMETE-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.00 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|